1,2-Dichloropropane is an organic compound classified as a chlorocarbon….1,2-Dichloropropane.
| Names | |
|---|---|
| Chemical formula | C3H6Cl2 |
| Molar mass | 112.98 g·mol−1 |
| Appearance | Colorless liquid |
| Odor | like chloroform |
What is the structural formula of 1/2-dichloropropane?
C3H6Cl2
1,2-Dichloropropane/Formula
What is the structural formula for the Iupac name of dichloropropane?
| IUPAC Name | 1,2-dichloropropane |
|---|---|
| Molecular Formula | C3H6Cl2 |
| Molar Mass | 112.981 g/mol |
| InChI | InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3 |
| InChI Key | KNKRKFALVUDBJE-UHFFFAOYSA-N |
Which is the structural formula of 1 1 dichloropropane?
1,1-dichloropropane/Formula
What is the formula of 1/3-dichloropropane?
1,3-Dichloropropane/Formula
What is the formula of propane?
C3H8
Propane/Formula
What is the formula of 1/3 dichloropropane?
How many isomers does 1 1 dichloropropane have?
And there you have the four isomers of dichloropropane.
How many dichloropropane are there?
They are 1,1-, 1,2-, 1,3-, and 2,2-dichloropropane.
Which of the following is formed when 2 2-dichloropropane reacts with AQ Koh?
In the presence of aqueous KOH , dichloropropane undergoes hydrolysis to form acetone. In this reaction chlorine atoms are replaced by the hydroxyl groups of potassium hydroxide.
What is condensed structural formula?
Condensed Structural Formula is basically a system in which we write organic molecules in a line of text. We basically write them in shorthand notation containing more detail than the molecular formula.
What is the condensed structural formula of propane?
Note
| Name | Molecular Formula (C nH 2 n + 2) | Condensed Structural Formula |
|---|---|---|
| methane | CH 4 | CH 4 |
| ethane | C 2H 6 | CH 3CH 3 |
| propane | C 3H 8 | CH 3CH 2CH 3 |
| butane | C 4H 10 | CH 3CH 2CH 2CH 3 |
What is the molecular formula for dichloropropane?
1,2-Dichloropropane PubChem CID 6564 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C3H6Cl2 Synonyms 1,2-DICHLOROPROPANE 78-87-5 Propylene di
Is trans-1 3 dichloropropene soluble in water?
Trans-1,3-dichloropropene appears as a clear colorless liquid with chloroform odor. Flash point 95° F. Density 1.225 g/cm3 and insoluble in water. Hence sinks in water. A strong irritant. Used as a soil fumigant.
Does dichloropropane occur naturally in the environment?
It does not occur naturally in the environment. 1,2-Dichloropropane production in the United States has declined over the past 20 years. It was used in the past as a soil fumigant, chemical intermediate and industrial solvent and was found in paint strippers, varnishes, and furniture finish removers. Most of these uses were discontinued.
How much dichloropropene is in Telone II?
DICHLOROPROPANE -DICHLOROPROPENE MIXTURE AS A SOIL FUMIGANT FOR CONTROL OF NEMATODES AFFECTING ROOTS OF PLANTS Telone II contains approximately 89% cis- and trans-1,3-dichloropropene, 2.5% 1,2-dichloropropene, 1.5% of a trichloropropene isomer, and 1.0% epichlorhydrin.
